About N'-(5-fluoro-2-pyridinyl)-N'-methylpropane-1,3-diamine
N'-(5-fluoro-2-pyridinyl)-N'-methylpropane-1,3-diamine (PubChem CID 61311958) has the molecular formula C9H14FN3
and a molecular weight of 183.23 g/mol. Its IUPAC name is N'-(5-fluoro-2-pyridinyl)-N'-methylpropane-1,3-diamine.
Analyze N'-(5-fluoro-2-pyridinyl)-N'-methylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-fluoro-2-pyridinyl)-N'-methylpropane-1,3-diamine?
The IUPAC name of N'-(5-fluoro-2-pyridinyl)-N'-methylpropane-1,3-diamine (CID 61311958) is N'-(5-fluoro-2-pyridinyl)-N'-methylpropane-1,3-diamine.
What is the SMILES notation for N'-(5-fluoro-2-pyridinyl)-N'-methylpropane-1,3-diamine?
The canonical SMILES for N'-(5-fluoro-2-pyridinyl)-N'-methylpropane-1,3-diamine is CN(CCCN)c1ccc(F)cn1.
What is the InChIKey of N'-(5-fluoro-2-pyridinyl)-N'-methylpropane-1,3-diamine?
The InChIKey is HMTDIVJRVNMXMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14FN3/c1-13(6-2-5-11)9-4-3-8(10)7-12-9/h3-4,7H,2,5-6,11H2,1H3.
What are the key properties of N'-(5-fluoro-2-pyridinyl)-N'-methylpropane-1,3-diamine?
N'-(5-fluoro-2-pyridinyl)-N'-methylpropane-1,3-diamine has a molecular weight of 183.23 g/mol, XLogP of 1.01, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-fluoro-2-pyridinyl)-N'-methylpropane-1,3-diamine is sourced from PubChem (CID 61311958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).