C10H16FN3 — CID 63766650
N'-(5-fluoro-2-pyridinyl)-N'-propylethane-1,2-diamine (PubChem CID 63766650) has the molecular formula C10H16FN3 and a molecular weight of 197.26 g/mol. Its IUPAC name is N'-(5-fluoro-2-pyridinyl)-N'-propylethane-1,2-diamine.
| Compound Name | N'-(5-fluoro-2-pyridinyl)-N'-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 63766650 |
| Molecular Formula | C10H16FN3 |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | N'-(5-fluoro-2-pyridinyl)-N'-propylethane-1,2-diamine |
| SMILES | CCCN(CCN)c1ccc(F)cn1 |
| InChI | InChI=1S/C10H16FN3/c1-2-6-14(7-5-12)10-4-3-9(11)8-13-10/h3-4,8H,2,5-7,12H2,1H3 |
| InChIKey | XJTOPLDOFQHAOO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |