About N'-(5-fluoro-2-pyridinyl)-N'-methylethane-1,2-diamine
N'-(5-fluoro-2-pyridinyl)-N'-methylethane-1,2-diamine (PubChem CID 62593517) has the molecular formula C8H12FN3
and a molecular weight of 169.20 g/mol. Its IUPAC name is N'-(5-fluoro-2-pyridinyl)-N'-methylethane-1,2-diamine.
Analyze N'-(5-fluoro-2-pyridinyl)-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-fluoro-2-pyridinyl)-N'-methylethane-1,2-diamine?
The IUPAC name of N'-(5-fluoro-2-pyridinyl)-N'-methylethane-1,2-diamine (CID 62593517) is N'-(5-fluoro-2-pyridinyl)-N'-methylethane-1,2-diamine.
What is the SMILES notation for N'-(5-fluoro-2-pyridinyl)-N'-methylethane-1,2-diamine?
The canonical SMILES for N'-(5-fluoro-2-pyridinyl)-N'-methylethane-1,2-diamine is CN(CCN)c1ccc(F)cn1.
What is the InChIKey of N'-(5-fluoro-2-pyridinyl)-N'-methylethane-1,2-diamine?
The InChIKey is KPSHRSJGBFVEDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12FN3/c1-12(5-4-10)8-3-2-7(9)6-11-8/h2-3,6H,4-5,10H2,1H3.
What are the key properties of N'-(5-fluoro-2-pyridinyl)-N'-methylethane-1,2-diamine?
N'-(5-fluoro-2-pyridinyl)-N'-methylethane-1,2-diamine has a molecular weight of 169.20 g/mol, XLogP of 0.62, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-fluoro-2-pyridinyl)-N'-methylethane-1,2-diamine is sourced from PubChem (CID 62593517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).