C12H14FN3 — CID 83837097
N'-(8-fluoroquinolin-2-yl)-N'-methylethane-1,2-diamine (PubChem CID 83837097) has the molecular formula C12H14FN3 and a molecular weight of 219.26 g/mol. Its IUPAC name is N'-(8-fluoroquinolin-2-yl)-N'-methylethane-1,2-diamine.
| Compound Name | N'-(8-fluoroquinolin-2-yl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 83837097 |
| Molecular Formula | C12H14FN3 |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | N'-(8-fluoroquinolin-2-yl)-N'-methylethane-1,2-diamine |
| SMILES | CN(CCN)c1ccc2cccc(F)c2n1 |
| InChI | InChI=1S/C12H14FN3/c1-16(8-7-14)11-6-5-9-3-2-4-10(13)12(9)15-11/h2-6H,7-8,14H2,1H3 |
| InChIKey | MIZQZHIIRFMDLB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |