C11H18BrN3 — CID 104779301
N'-(3-bromo-4-pyridinyl)-N,N'-diethylethane-1,2-diamine (PubChem CID 104779301) has the molecular formula C11H18BrN3 and a molecular weight of 272.19 g/mol. Its IUPAC name is N'-(3-bromo-4-pyridinyl)-N,N'-diethylethane-1,2-diamine.
| Compound Name | N'-(3-bromo-4-pyridinyl)-N,N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 104779301 |
| Molecular Formula | C11H18BrN3 |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | N'-(3-bromo-4-pyridinyl)-N,N'-diethylethane-1,2-diamine |
| SMILES | CCNCCN(CC)c1ccncc1Br |
| InChI | InChI=1S/C11H18BrN3/c1-3-13-7-8-15(4-2)11-5-6-14-9-10(11)12/h5-6,9,13H,3-4,7-8H2,1-2H3 |
| InChIKey | FZRMRTYMBHDDCZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|