C10H17FN4 — CID 104606633
N,N'-diethyl-N'-(5-fluoropyrimidin-2-yl)ethane-1,2-diamine (PubChem CID 104606633) has the molecular formula C10H17FN4 and a molecular weight of 212.27 g/mol. Its IUPAC name is N,N'-diethyl-N'-(5-fluoropyrimidin-2-yl)ethane-1,2-diamine.
| Compound Name | N,N'-diethyl-N'-(5-fluoropyrimidin-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 104606633 |
| Molecular Formula | C10H17FN4 |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | N,N'-diethyl-N'-(5-fluoropyrimidin-2-yl)ethane-1,2-diamine |
| SMILES | CCNCCN(CC)c1ncc(F)cn1 |
| InChI | InChI=1S/C10H17FN4/c1-3-12-5-6-15(4-2)10-13-7-9(11)8-14-10/h7-8,12H,3-6H2,1-2H3 |
| InChIKey | WTDCJQZPZPTSQK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|