C12H22N4O — CID 112639133
N'-(4-ethoxypyrimidin-2-yl)-N,N'-diethylethane-1,2-diamine (PubChem CID 112639133) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is N'-(4-ethoxypyrimidin-2-yl)-N,N'-diethylethane-1,2-diamine.
| Compound Name | N'-(4-ethoxypyrimidin-2-yl)-N,N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 112639133 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | N'-(4-ethoxypyrimidin-2-yl)-N,N'-diethylethane-1,2-diamine |
| SMILES | CCNCCN(CC)c1nccc(OCC)n1 |
| InChI | InChI=1S/C12H22N4O/c1-4-13-9-10-16(5-2)12-14-8-7-11(15-12)17-6-3/h7-8,13H,4-6,9-10H2,1-3H3 |
| InChIKey | NXWZKVGDJSWFCP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|