C12H19N3O3 — CID 112635997
3-[(4-ethoxypyrimidin-2-yl)-propan-2-ylamino]propanoic acid (PubChem CID 112635997) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-[(4-ethoxypyrimidin-2-yl)-propan-2-ylamino]propanoic acid.
| Compound Name | 3-[(4-ethoxypyrimidin-2-yl)-propan-2-ylamino]propanoic acid |
|---|---|
| PubChem CID | 112635997 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 3-[(4-ethoxypyrimidin-2-yl)-propan-2-ylamino]propanoic acid |
| SMILES | CCOc1ccnc(N(CCC(=O)O)C(C)C)n1 |
| InChI | InChI=1S/C12H19N3O3/c1-4-18-10-5-7-13-12(14-10)15(9(2)3)8-6-11(16)17/h5,7,9H,4,6,8H2,1-3H3,(H,16,17) |
| InChIKey | FCDLBYMLHLSIHD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |