C11H19ClN4O — CID 80753181
N'-(5-chloro-2-methoxypyrimidin-4-yl)-N,N'-diethylethane-1,2-diamine (PubChem CID 80753181) has the molecular formula C11H19ClN4O and a molecular weight of 258.75 g/mol. Its IUPAC name is N'-(5-chloro-2-methoxypyrimidin-4-yl)-N,N'-diethylethane-1,2-diamine.
| Compound Name | N'-(5-chloro-2-methoxypyrimidin-4-yl)-N,N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 80753181 |
| Molecular Formula | C11H19ClN4O |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | N'-(5-chloro-2-methoxypyrimidin-4-yl)-N,N'-diethylethane-1,2-diamine |
| SMILES | CCNCCN(CC)c1nc(OC)ncc1Cl |
| InChI | InChI=1S/C11H19ClN4O/c1-4-13-6-7-16(5-2)10-9(12)8-14-11(15-10)17-3/h8,13H,4-7H2,1-3H3 |
| InChIKey | VAGWCEVAAHNBHQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|