C14H25ClN4O4 — CID 126809366
2-[3-[[5-chloro-2-[3-(2-hydroxyethoxy)propylamino]pyrimidin-4-yl]amino]propoxy]ethanol (PubChem CID 126809366) has the molecular formula C14H25ClN4O4 and a molecular weight of 348.83 g/mol. Its IUPAC name is 2-[3-[[5-chloro-2-[3-(2-hydroxyethoxy)propylamino]pyrimidin-4-yl]amino]propoxy]ethanol.
| Compound Name | 2-[3-[[5-chloro-2-[3-(2-hydroxyethoxy)propylamino]pyrimidin-4-yl]amino]propoxy]ethanol |
|---|---|
| PubChem CID | 126809366 |
| Molecular Formula | C14H25ClN4O4 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 2-[3-[[5-chloro-2-[3-(2-hydroxyethoxy)propylamino]pyrimidin-4-yl]amino]propoxy]ethanol |
| SMILES | OCCOCCCNc1ncc(Cl)c(NCCCOCCO)n1 |
| InChI | InChI=1S/C14H25ClN4O4/c15-12-11-18-14(17-4-2-8-23-10-6-21)19-13(12)16-3-1-7-22-9-5-20/h11,20-21H,1-10H2,(H2,16,17,18,19) |
| InChIKey | LYVMKSXEKNBXAR-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 108.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|