C8H10Cl2FN3O — CID 137418582
3-[(2,5-dichloropyrimidin-4-yl)amino]-2-fluorobutan-1-ol (PubChem CID 137418582) has the molecular formula C8H10Cl2FN3O and a molecular weight of 254.09 g/mol. Its IUPAC name is 3-[(2,5-dichloropyrimidin-4-yl)amino]-2-fluorobutan-1-ol.
| Compound Name | 3-[(2,5-dichloropyrimidin-4-yl)amino]-2-fluorobutan-1-ol |
|---|---|
| PubChem CID | 137418582 |
| Molecular Formula | C8H10Cl2FN3O |
| Molecular Weight | 254.09 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 3-[(2,5-dichloropyrimidin-4-yl)amino]-2-fluorobutan-1-ol |
| SMILES | CC(Nc1nc(Cl)ncc1Cl)C(F)CO |
| InChI | InChI=1S/C8H10Cl2FN3O/c1-4(6(11)3-15)13-7-5(9)2-12-8(10)14-7/h2,4,6,15H,3H2,1H3,(H,12,13,14) |
| InChIKey | WWSIBFPNYOSCKQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.09 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |