C8H10Cl2FN3OS — CID 137418289
2,5-dichloro-N-(2-fluoro-3-methylsulfanyloxypropyl)pyrimidin-4-amine (PubChem CID 137418289) has the molecular formula C8H10Cl2FN3OS and a molecular weight of 286.16 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-fluoro-3-methylsulfanyloxypropyl)pyrimidin-4-amine.
| Compound Name | 2,5-dichloro-N-(2-fluoro-3-methylsulfanyloxypropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 137418289 |
| Molecular Formula | C8H10Cl2FN3OS |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | 2,5-dichloro-N-(2-fluoro-3-methylsulfanyloxypropyl)pyrimidin-4-amine |
| SMILES | CSOCC(F)CNc1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C8H10Cl2FN3OS/c1-16-15-4-5(11)2-12-7-6(9)3-13-8(10)14-7/h3,5H,2,4H2,1H3,(H,12,13,14) |
| InChIKey | XCGFVRRBYZYTFE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|