C14H21F3N2O — CID 107481554
2-[4-(ethylaminomethyl)-2-methyl-N-(2,2,2-trifluoroethyl)anilino]ethanol (PubChem CID 107481554) has the molecular formula C14H21F3N2O and a molecular weight of 290.33 g/mol. Its IUPAC name is 2-[4-(ethylaminomethyl)-2-methyl-N-(2,2,2-trifluoroethyl)anilino]ethanol.
| Compound Name | 2-[4-(ethylaminomethyl)-2-methyl-N-(2,2,2-trifluoroethyl)anilino]ethanol |
|---|---|
| PubChem CID | 107481554 |
| Molecular Formula | C14H21F3N2O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 2-[4-(ethylaminomethyl)-2-methyl-N-(2,2,2-trifluoroethyl)anilino]ethanol |
| SMILES | CCNCc1ccc(N(CCO)CC(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C14H21F3N2O/c1-3-18-9-12-4-5-13(11(2)8-12)19(6-7-20)10-14(15,16)17/h4-5,8,18,20H,3,6-7,9-10H2,1-2H3 |
| InChIKey | HRBNLXAEVOTVNZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|