C16H28N2 — CID 62122953
N-(2,2-dimethylpropyl)-4-(ethylaminomethyl)-N,2-dimethylaniline (PubChem CID 62122953) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-4-(ethylaminomethyl)-N,2-dimethylaniline.
| Compound Name | N-(2,2-dimethylpropyl)-4-(ethylaminomethyl)-N,2-dimethylaniline |
|---|---|
| PubChem CID | 62122953 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | N-(2,2-dimethylpropyl)-4-(ethylaminomethyl)-N,2-dimethylaniline |
| SMILES | CCNCc1ccc(N(C)CC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C16H28N2/c1-7-17-11-14-8-9-15(13(2)10-14)18(6)12-16(3,4)5/h8-10,17H,7,11-12H2,1-6H3 |
| InChIKey | LMJRRYBTSVITKR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|