C14H24N2 — CID 62119969
N-ethyl-N,2-dimethyl-4-(propylaminomethyl)aniline (PubChem CID 62119969) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is N-ethyl-N,2-dimethyl-4-(propylaminomethyl)aniline.
| Compound Name | N-ethyl-N,2-dimethyl-4-(propylaminomethyl)aniline |
|---|---|
| PubChem CID | 62119969 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N-ethyl-N,2-dimethyl-4-(propylaminomethyl)aniline |
| SMILES | CCCNCc1ccc(N(C)CC)c(C)c1 |
| InChI | InChI=1S/C14H24N2/c1-5-9-15-11-13-7-8-14(12(3)10-13)16(4)6-2/h7-8,10,15H,5-6,9,11H2,1-4H3 |
| InChIKey | QAWGLBITSIREQG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|