C12H10F8O — CID 156764671
4,4,5,5,6,6,6-heptafluoro-2-(4-fluorophenyl)hexan-2-ol (PubChem CID 156764671) has the molecular formula C12H10F8O and a molecular weight of 322.20 g/mol. Its IUPAC name is 4,4,5,5,6,6,6-heptafluoro-2-(4-fluorophenyl)hexan-2-ol.
| Compound Name | 4,4,5,5,6,6,6-heptafluoro-2-(4-fluorophenyl)hexan-2-ol |
|---|---|
| PubChem CID | 156764671 |
| Molecular Formula | C12H10F8O |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 4,4,5,5,6,6,6-heptafluoro-2-(4-fluorophenyl)hexan-2-ol |
| SMILES | CC(O)(CC(F)(F)C(F)(F)C(F)(F)F)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H10F8O/c1-9(21,7-2-4-8(13)5-3-7)6-10(14,15)11(16,17)12(18,19)20/h2-5,21H,6H2,1H3 |
| InChIKey | PZRBMNBOBRHTRA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|