C9H10N2O2S — CID 12869182
4-methyl-5-nitro-2,3-dihydro-1,4-benzothiazine (PubChem CID 12869182) has the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. Its IUPAC name is 4-methyl-5-nitro-2,3-dihydro-1,4-benzothiazine.
| Compound Name | 4-methyl-5-nitro-2,3-dihydro-1,4-benzothiazine |
|---|---|
| PubChem CID | 12869182 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 4-methyl-5-nitro-2,3-dihydro-1,4-benzothiazine |
| SMILES | CN1CCSc2cccc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C9H10N2O2S/c1-10-5-6-14-8-4-2-3-7(9(8)10)11(12)13/h2-4H,5-6H2,1H3 |
| InChIKey | UAUUZASFHVDLFZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|