C10H12N2OS — CID 130044587
4-amino-3,4-dihydro-2H-thiochromene-8-carboxamide (PubChem CID 130044587) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is 4-amino-3,4-dihydro-2H-thiochromene-8-carboxamide.
| Compound Name | 4-amino-3,4-dihydro-2H-thiochromene-8-carboxamide |
|---|---|
| PubChem CID | 130044587 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 4-amino-3,4-dihydro-2H-thiochromene-8-carboxamide |
| SMILES | NC(=O)c1cccc2c1SCCC2N |
| InChI | InChI=1S/C10H12N2OS/c11-8-4-5-14-9-6(8)2-1-3-7(9)10(12)13/h1-3,8H,4-5,11H2,(H2,12,13) |
| InChIKey | KNIODHXJEDDCKX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |