C10H12N2O — CID 85263754
3-amino-2,3-dihydro-1H-indene-4-carboxamide (PubChem CID 85263754) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 3-amino-2,3-dihydro-1H-indene-4-carboxamide.
| Compound Name | 3-amino-2,3-dihydro-1H-indene-4-carboxamide |
|---|---|
| PubChem CID | 85263754 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 3-amino-2,3-dihydro-1H-indene-4-carboxamide |
| SMILES | NC(=O)c1cccc2c1C(N)CC2 |
| InChI | InChI=1S/C10H12N2O/c11-8-5-4-6-2-1-3-7(9(6)8)10(12)13/h1-3,8H,4-5,11H2,(H2,12,13) |
| InChIKey | QZTLPTSRBLNPTE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |