C10H12O2S — CID 117200294
3-(2-hydroxyethyl)-2,3-dihydro-1-benzothiophen-4-ol (PubChem CID 117200294) has the molecular formula C10H12O2S and a molecular weight of 196.27 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-2,3-dihydro-1-benzothiophen-4-ol.
| Compound Name | 3-(2-hydroxyethyl)-2,3-dihydro-1-benzothiophen-4-ol |
|---|---|
| PubChem CID | 117200294 |
| Molecular Formula | C10H12O2S |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 3-(2-hydroxyethyl)-2,3-dihydro-1-benzothiophen-4-ol |
| SMILES | OCCC1CSc2cccc(O)c21 |
| InChI | InChI=1S/C10H12O2S/c11-5-4-7-6-13-9-3-1-2-8(12)10(7)9/h1-3,7,11-12H,4-6H2 |
| InChIKey | GVOAZDDZIZONEO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |