C11H14OS — CID 117203035
1-(3-methyl-2,3-dihydro-1-benzothiophen-4-yl)ethanol (PubChem CID 117203035) has the molecular formula C11H14OS and a molecular weight of 194.30 g/mol. Its IUPAC name is 1-(3-methyl-2,3-dihydro-1-benzothiophen-4-yl)ethanol.
| Compound Name | 1-(3-methyl-2,3-dihydro-1-benzothiophen-4-yl)ethanol |
|---|---|
| PubChem CID | 117203035 |
| Molecular Formula | C11H14OS |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 1-(3-methyl-2,3-dihydro-1-benzothiophen-4-yl)ethanol |
| SMILES | CC(O)c1cccc2c1C(C)CS2 |
| InChI | InChI=1S/C11H14OS/c1-7-6-13-10-5-3-4-9(8(2)12)11(7)10/h3-5,7-8,12H,6H2,1-2H3 |
| InChIKey | ZNLBWGWYWCHDQE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |