About 2-(4-hydroxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid
2-(4-hydroxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid (PubChem CID 117200338) has the molecular formula C10H10O3S
and a molecular weight of 210.25 g/mol. Its IUPAC name is 2-(4-hydroxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid.
Analyze 2-(4-hydroxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid?
The IUPAC name of 2-(4-hydroxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid (CID 117200338) is 2-(4-hydroxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid.
What is the SMILES notation for 2-(4-hydroxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid?
The canonical SMILES for 2-(4-hydroxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid is O=C(O)CC1CSc2cccc(O)c21.
What is the InChIKey of 2-(4-hydroxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid?
The InChIKey is KDGPTNJRDIBCMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3S/c11-7-2-1-3-8-10(7)6(5-14-8)4-9(12)13/h1-3,6,11H,4-5H2,(H,12,13).
What are the key properties of 2-(4-hydroxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid?
2-(4-hydroxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid has a molecular weight of 210.25 g/mol, XLogP of 2.06, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxy-2,3-dihydro-1-benzothiophen-3-yl)acetic acid is sourced from PubChem (CID 117200338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).