C19H16N2O4 — CID 118953294
ethyl (2S)-6-(1,3-dioxoisoindol-2-yl)-2,3-dihydro-1H-indole-2-carboxylate (PubChem CID 118953294) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is ethyl (2S)-6-(1,3-dioxoisoindol-2-yl)-2,3-dihydro-1H-indole-2-carboxylate.
| Compound Name | ethyl (2S)-6-(1,3-dioxoisoindol-2-yl)-2,3-dihydro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 118953294 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | ethyl (2S)-6-(1,3-dioxoisoindol-2-yl)-2,3-dihydro-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1Cc2ccc(N3C(=O)c4ccccc4C3=O)cc2N1 |
| InChI | InChI=1S/C19H16N2O4/c1-2-25-19(24)16-9-11-7-8-12(10-15(11)20-16)21-17(22)13-5-3-4-6-14(13)18(21)23/h3-8,10,16,20H,2,9H2,1H3/t16-/m0/s1 |
| InChIKey | WHVYODUHFDFPTQ-INIZCTEOSA-N |
| XLogP | 2.39 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|