C35H36N4O7 — CID 118953230
ethyl (2S)-6-(1,3-dioxoisoindol-2-yl)-1-[2-[3-methylpentanoyl-[(2-phenylacetyl)amino]amino]acetyl]-2,3-dihydroindole-2-carboxylate (PubChem CID 118953230) has the molecular formula C35H36N4O7 and a molecular weight of 624.69 g/mol. Its IUPAC name is ethyl (2S)-6-(1,3-dioxoisoindol-2-yl)-1-[2-[3-methylpentanoyl-[(2-phenylacetyl)amino]amino]acetyl]-2,3-dihydroindole-2-carboxylate.
| Compound Name | ethyl (2S)-6-(1,3-dioxoisoindol-2-yl)-1-[2-[3-methylpentanoyl-[(2-phenylacetyl)amino]amino]acetyl]-2,3-dihydroindole-2-carboxylate |
|---|---|
| PubChem CID | 118953230 |
| Molecular Formula | C35H36N4O7 |
| Molecular Weight | 624.69 g/mol |
| Exact Mass | 624.26 |
| IUPAC Name | ethyl (2S)-6-(1,3-dioxoisoindol-2-yl)-1-[2-[3-methylpentanoyl-[(2-phenylacetyl)amino]amino]acetyl]-2,3-dihydroindole-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1Cc2ccc(N3C(=O)c4ccccc4C3=O)cc2N1C(=O)CN(NC(=O)Cc1ccccc1)C(=O)CC(C)CC |
| InChI | InChI=1S/C35H36N4O7/c1-4-22(3)17-31(41)37(36-30(40)18-23-11-7-6-8-12-23)21-32(42)39-28-20-25(16-15-24(28)19-29(39)35(45)46-5-2)38-33(43)26-13-9-10-14-27(26)34(38)44/h6-16,20,22,29H,4-5,17-19,21H2,1-3H3,(H,36,40)/t22?,29-/m0/s1 |
| InChIKey | XKNMQPOUXNLXJG-JKDDQTOVSA-N |
| XLogP | 3.85 |
| TPSA | 133.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.69 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|