C24H29NO4 — CID 145416176
cyclohexyl 4-[[[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]methyl]benzoate (PubChem CID 145416176) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is cyclohexyl 4-[[[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]methyl]benzoate.
| Compound Name | cyclohexyl 4-[[[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 145416176 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | cyclohexyl 4-[[[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]methyl]benzoate |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)NCc1ccc(C(=O)OC2CCCCC2)cc1 |
| InChI | InChI=1S/C24H29NO4/c1-28-24(27)22(16-18-8-4-2-5-9-18)25-17-19-12-14-20(15-13-19)23(26)29-21-10-6-3-7-11-21/h2,4-5,8-9,12-15,21-22,25H,3,6-7,10-11,16-17H2,1H3/t22-/m1/s1 |
| InChIKey | ITYCJVRCEACYOK-JOCHJYFZSA-N |
| XLogP | 4.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |