C19H28N2O5 — CID 22673435
2-[[2-benzyl-3-[formyl(hydroxy)amino]propanoyl]amino]-3,3-dimethylhexanoic acid (PubChem CID 22673435) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is 2-[[2-benzyl-3-[formyl(hydroxy)amino]propanoyl]amino]-3,3-dimethylhexanoic acid.
| Compound Name | 2-[[2-benzyl-3-[formyl(hydroxy)amino]propanoyl]amino]-3,3-dimethylhexanoic acid |
|---|---|
| PubChem CID | 22673435 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 2-[[2-benzyl-3-[formyl(hydroxy)amino]propanoyl]amino]-3,3-dimethylhexanoic acid |
| SMILES | CCCC(C)(C)C(NC(=O)C(Cc1ccccc1)CN(O)C=O)C(=O)O |
| InChI | InChI=1S/C19H28N2O5/c1-4-10-19(2,3)16(18(24)25)20-17(23)15(12-21(26)13-22)11-14-8-6-5-7-9-14/h5-9,13,15-16,26H,4,10-12H2,1-3H3,(H,20,23)(H,24,25) |
| InChIKey | WJTULAQQSAOFMD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|