C20H22N2O5 — CID 54496020
(2S)-2-[[2-benzyl-3-[formyl(hydroxy)amino]propanoyl]amino]-3-phenylpropanoic acid (PubChem CID 54496020) has the molecular formula C20H22N2O5 and a molecular weight of 370.40 g/mol. Its IUPAC name is (2S)-2-[[2-benzyl-3-[formyl(hydroxy)amino]propanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[2-benzyl-3-[formyl(hydroxy)amino]propanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 54496020 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (2S)-2-[[2-benzyl-3-[formyl(hydroxy)amino]propanoyl]amino]-3-phenylpropanoic acid |
| SMILES | O=CN(O)CC(Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H22N2O5/c23-14-22(27)13-17(11-15-7-3-1-4-8-15)19(24)21-18(20(25)26)12-16-9-5-2-6-10-16/h1-10,14,17-18,27H,11-13H2,(H,21,24)(H,25,26)/t17?,18-/m0/s1 |
| InChIKey | XZEDLACBSIXUKF-ZVAWYAOSSA-N |
| XLogP | 1.50 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|