C31H38N4O8S — CID 141460867
(2R)-2-pentyl-N'-phenylmethoxy-N-[[[5-[3-(propanoylsulfamoyl)phenyl]furan-2-carbonyl]amino]methyl]butanediamide (PubChem CID 141460867) has the molecular formula C31H38N4O8S and a molecular weight of 626.73 g/mol. Its IUPAC name is (2R)-2-pentyl-N'-phenylmethoxy-N-[[[5-[3-(propanoylsulfamoyl)phenyl]furan-2-carbonyl]amino]methyl]butanediamide.
| Compound Name | (2R)-2-pentyl-N'-phenylmethoxy-N-[[[5-[3-(propanoylsulfamoyl)phenyl]furan-2-carbonyl]amino]methyl]butanediamide |
|---|---|
| PubChem CID | 141460867 |
| Molecular Formula | C31H38N4O8S |
| Molecular Weight | 626.73 g/mol |
| Exact Mass | 626.24 |
| IUPAC Name | (2R)-2-pentyl-N'-phenylmethoxy-N-[[[5-[3-(propanoylsulfamoyl)phenyl]furan-2-carbonyl]amino]methyl]butanediamide |
| SMILES | CCCCC[C@H](CC(=O)NOCc1ccccc1)C(=O)NCNC(=O)c1ccc(-c2cccc(S(=O)(=O)NC(=O)CC)c2)o1 |
| InChI | InChI=1S/C31H38N4O8S/c1-3-5-7-13-24(19-29(37)34-42-20-22-11-8-6-9-12-22)30(38)32-21-33-31(39)27-17-16-26(43-27)23-14-10-15-25(18-23)44(40,41)35-28(36)4-2/h6,8-12,14-18,24H,3-5,7,13,19-21H2,1-2H3,(H,32,38)(H,33,39)(H,34,37)(H,35,36)/t24-/m1/s1 |
| InChIKey | RSJCLQVAUCCWCR-XMMPIXPASA-N |
| XLogP | 3.80 |
| TPSA | 172.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.73 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|