C22H20N2O6 — CID 5262308
butyl 2-[[5-(3-nitrophenyl)furan-2-carbonyl]amino]benzoate (PubChem CID 5262308) has the molecular formula C22H20N2O6 and a molecular weight of 408.41 g/mol. Its IUPAC name is butyl 2-[[5-(3-nitrophenyl)furan-2-carbonyl]amino]benzoate.
| Compound Name | butyl 2-[[5-(3-nitrophenyl)furan-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 5262308 |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | butyl 2-[[5-(3-nitrophenyl)furan-2-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)c1ccc(-c2cccc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C22H20N2O6/c1-2-3-13-29-22(26)17-9-4-5-10-18(17)23-21(25)20-12-11-19(30-20)15-7-6-8-16(14-15)24(27)28/h4-12,14H,2-3,13H2,1H3,(H,23,25) |
| InChIKey | YUUBIXDAUAXOQB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|