C23H20N2O7 — CID 5262315
oxolan-2-ylmethyl 2-[[5-(3-nitrophenyl)furan-2-carbonyl]amino]benzoate (PubChem CID 5262315) has the molecular formula C23H20N2O7 and a molecular weight of 436.42 g/mol. Its IUPAC name is oxolan-2-ylmethyl 2-[[5-(3-nitrophenyl)furan-2-carbonyl]amino]benzoate.
| Compound Name | oxolan-2-ylmethyl 2-[[5-(3-nitrophenyl)furan-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 5262315 |
| Molecular Formula | C23H20N2O7 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | oxolan-2-ylmethyl 2-[[5-(3-nitrophenyl)furan-2-carbonyl]amino]benzoate |
| SMILES | O=C(Nc1ccccc1C(=O)OCC1CCCO1)c1ccc(-c2cccc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C23H20N2O7/c26-22(21-11-10-20(32-21)15-5-3-6-16(13-15)25(28)29)24-19-9-2-1-8-18(19)23(27)31-14-17-7-4-12-30-17/h1-3,5-6,8-11,13,17H,4,7,12,14H2,(H,24,26) |
| InChIKey | VZAGHXSHPCQIFD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|