C30H40N3O12P — CID 137360873
[3-ethoxy-5-[5-[[2-[1-[formyl-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]phosphonic acid (PubChem CID 137360873) has the molecular formula C30H40N3O12P and a molecular weight of 665.63 g/mol. Its IUPAC name is [3-ethoxy-5-[5-[[2-[1-[formyl-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]phosphonic acid.
| Compound Name | [3-ethoxy-5-[5-[[2-[1-[formyl-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 137360873 |
| Molecular Formula | C30H40N3O12P |
| Molecular Weight | 665.63 g/mol |
| Exact Mass | 665.23 |
| IUPAC Name | [3-ethoxy-5-[5-[[2-[1-[formyl-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]phosphonic acid |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2cc(OCC)cc(P(=O)(O)O)c2)o1)C(CC)N(C=O)OCc1oc(=O)oc1C |
| InChI | InChI=1S/C30H40N3O12P/c1-5-8-9-10-23(24(6-2)33(18-34)42-16-27-19(4)43-30(37)45-27)28(35)31-17-32-29(36)26-12-11-25(44-26)20-13-21(41-7-3)15-22(14-20)46(38,39)40/h11-15,18,23-24H,5-10,16-17H2,1-4H3,(H,31,35)(H,32,36)(H2,38,39,40) |
| InChIKey | XPYADGDJYKUHNG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 210.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.63 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|