C38H43N3O9 — CID 118225891
ethyl 5-ethoxy-3-[5-[[[(2R,3R)-3-[formyl(phenylmethoxy)amino]-2-(2-phenylethyl)pentanoyl]amino]methylcarbamoyl]furan-2-yl]-2-hydroxybenzoate (PubChem CID 118225891) has the molecular formula C38H43N3O9 and a molecular weight of 685.77 g/mol. Its IUPAC name is ethyl 5-ethoxy-3-[5-[[[(2R,3R)-3-[formyl(phenylmethoxy)amino]-2-(2-phenylethyl)pentanoyl]amino]methylcarbamoyl]furan-2-yl]-2-hydroxybenzoate.
| Compound Name | ethyl 5-ethoxy-3-[5-[[[(2R,3R)-3-[formyl(phenylmethoxy)amino]-2-(2-phenylethyl)pentanoyl]amino]methylcarbamoyl]furan-2-yl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 118225891 |
| Molecular Formula | C38H43N3O9 |
| Molecular Weight | 685.77 g/mol |
| Exact Mass | 685.30 |
| IUPAC Name | ethyl 5-ethoxy-3-[5-[[[(2R,3R)-3-[formyl(phenylmethoxy)amino]-2-(2-phenylethyl)pentanoyl]amino]methylcarbamoyl]furan-2-yl]-2-hydroxybenzoate |
| SMILES | CCOC(=O)c1cc(OCC)cc(-c2ccc(C(=O)NCNC(=O)[C@H](CCc3ccccc3)[C@@H](CC)N(C=O)OCc3ccccc3)o2)c1O |
| InChI | InChI=1S/C38H43N3O9/c1-4-32(41(25-42)49-23-27-15-11-8-12-16-27)29(18-17-26-13-9-7-10-14-26)36(44)39-24-40-37(45)34-20-19-33(50-34)30-21-28(47-5-2)22-31(35(30)43)38(46)48-6-3/h7-16,19-22,25,29,32,43H,4-6,17-18,23-24H2,1-3H3,(H,39,44)(H,40,45)/t29-,32-/m1/s1 |
| InChIKey | ABDTWGVRRHRUPA-QLWXXVCSSA-N |
| XLogP | 5.65 |
| TPSA | 156.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.77 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|