C38H39F2N3O11 — CID 123243641
methyl 3-[5-[[[2-[2-(2,4-difluorophenyl)ethyl]-3-[formyl(phenylmethoxy)amino]pentanoyl]amino]methylcarbamoyl]furan-2-yl]-2-hydroxy-5-(2-methoxy-2-oxoethoxy)benzoate (PubChem CID 123243641) has the molecular formula C38H39F2N3O11 and a molecular weight of 751.74 g/mol. Its IUPAC name is methyl 3-[5-[[[2-[2-(2,4-difluorophenyl)ethyl]-3-[formyl(phenylmethoxy)amino]pentanoyl]amino]methylcarbamoyl]furan-2-yl]-2-hydroxy-5-(2-methoxy-2-oxoethoxy)benzoate.
| Compound Name | methyl 3-[5-[[[2-[2-(2,4-difluorophenyl)ethyl]-3-[formyl(phenylmethoxy)amino]pentanoyl]amino]methylcarbamoyl]furan-2-yl]-2-hydroxy-5-(2-methoxy-2-oxoethoxy)benzoate |
|---|---|
| PubChem CID | 123243641 |
| Molecular Formula | C38H39F2N3O11 |
| Molecular Weight | 751.74 g/mol |
| Exact Mass | 751.26 |
| IUPAC Name | methyl 3-[5-[[[2-[2-(2,4-difluorophenyl)ethyl]-3-[formyl(phenylmethoxy)amino]pentanoyl]amino]methylcarbamoyl]furan-2-yl]-2-hydroxy-5-(2-methoxy-2-oxoethoxy)benzoate |
| SMILES | CCC(C(CCc1ccc(F)cc1F)C(=O)NCNC(=O)c1ccc(-c2cc(OCC(=O)OC)cc(C(=O)OC)c2O)o1)N(C=O)OCc1ccccc1 |
| InChI | InChI=1S/C38H39F2N3O11/c1-4-31(43(22-44)53-19-23-8-6-5-7-9-23)27(13-11-24-10-12-25(39)16-30(24)40)36(47)41-21-42-37(48)33-15-14-32(54-33)28-17-26(52-20-34(45)50-2)18-29(35(28)46)38(49)51-3/h5-10,12,14-18,22,27,31,46H,4,11,13,19-21H2,1-3H3,(H,41,47)(H,42,48) |
| InChIKey | SKMUJBGFRTXGRO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 182.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.74 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|