C32H39N3O6 — CID 144883826
4-[4-[[2-[1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methylcarbamoyl]cyclopenta-1,3-dien-1-yl]benzoic acid (PubChem CID 144883826) has the molecular formula C32H39N3O6 and a molecular weight of 561.68 g/mol. Its IUPAC name is 4-[4-[[2-[1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methylcarbamoyl]cyclopenta-1,3-dien-1-yl]benzoic acid.
| Compound Name | 4-[4-[[2-[1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methylcarbamoyl]cyclopenta-1,3-dien-1-yl]benzoic acid |
|---|---|
| PubChem CID | 144883826 |
| Molecular Formula | C32H39N3O6 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.28 |
| IUPAC Name | 4-[4-[[2-[1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methylcarbamoyl]cyclopenta-1,3-dien-1-yl]benzoic acid |
| SMILES | CCCCCC(C(=O)NCNC(=O)C1=CC=C(c2ccc(C(=O)O)cc2)C1)C(CC)N(C=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H39N3O6/c1-3-5-7-12-28(29(4-2)35(22-36)41-20-23-10-8-6-9-11-23)31(38)34-21-33-30(37)27-18-17-26(19-27)24-13-15-25(16-14-24)32(39)40/h6,8-11,13-18,22,28-29H,3-5,7,12,19-21H2,1-2H3,(H,33,37)(H,34,38)(H,39,40) |
| InChIKey | LFUKOOVQIAXBQF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|