C21H34N3O9P — CID 137361361
[[(2R)-2-[(1R)-1-[formyl-[[hydroxy(phenylmethoxy)phosphoryl]oxymethoxy]amino]propyl]heptanoyl]amino]methylcarbamic acid (PubChem CID 137361361) has the molecular formula C21H34N3O9P and a molecular weight of 503.49 g/mol. Its IUPAC name is [[(2R)-2-[(1R)-1-[formyl-[[hydroxy(phenylmethoxy)phosphoryl]oxymethoxy]amino]propyl]heptanoyl]amino]methylcarbamic acid.
| Compound Name | [[(2R)-2-[(1R)-1-[formyl-[[hydroxy(phenylmethoxy)phosphoryl]oxymethoxy]amino]propyl]heptanoyl]amino]methylcarbamic acid |
|---|---|
| PubChem CID | 137361361 |
| Molecular Formula | C21H34N3O9P |
| Molecular Weight | 503.49 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | [[(2R)-2-[(1R)-1-[formyl-[[hydroxy(phenylmethoxy)phosphoryl]oxymethoxy]amino]propyl]heptanoyl]amino]methylcarbamic acid |
| SMILES | CCCCC[C@@H](C(=O)NCNC(=O)O)[C@@H](CC)N(C=O)OCOP(=O)(O)OCc1ccccc1 |
| InChI | InChI=1S/C21H34N3O9P/c1-3-5-7-12-18(20(26)22-14-23-21(27)28)19(4-2)24(15-25)31-16-33-34(29,30)32-13-17-10-8-6-9-11-17/h6,8-11,15,18-19,23H,3-5,7,12-14,16H2,1-2H3,(H,22,26)(H,27,28)(H,29,30)/t18-,19-/m1/s1 |
| InChIKey | QVIROBVTWDOZHE-RTBURBONSA-N |
| XLogP | 2.98 |
| TPSA | 163.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|