C22H26BrNO5 — CID 56986499
3-[4-(5-bromopentoxy)phenyl]-2-[formyl(phenylmethoxy)amino]propanoic acid (PubChem CID 56986499) has the molecular formula C22H26BrNO5 and a molecular weight of 464.36 g/mol. Its IUPAC name is 3-[4-(5-bromopentoxy)phenyl]-2-[formyl(phenylmethoxy)amino]propanoic acid.
| Compound Name | 3-[4-(5-bromopentoxy)phenyl]-2-[formyl(phenylmethoxy)amino]propanoic acid |
|---|---|
| PubChem CID | 56986499 |
| Molecular Formula | C22H26BrNO5 |
| Molecular Weight | 464.36 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 3-[4-(5-bromopentoxy)phenyl]-2-[formyl(phenylmethoxy)amino]propanoic acid |
| SMILES | O=CN(OCc1ccccc1)C(Cc1ccc(OCCCCCBr)cc1)C(=O)O |
| InChI | InChI=1S/C22H26BrNO5/c23-13-5-2-6-14-28-20-11-9-18(10-12-20)15-21(22(26)27)24(17-25)29-16-19-7-3-1-4-8-19/h1,3-4,7-12,17,21H,2,5-6,13-16H2,(H,26,27) |
| InChIKey | VCOSHOKHWITKIR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|