C35H47Cl2NO4 — CID 10121778
8-(4-phenylmethoxyphenoxy)octyl 2-[4-chlorobutyl(methyl)amino]-3-phenylpropanoate;hydrochloride (PubChem CID 10121778) has the molecular formula C35H47Cl2NO4 and a molecular weight of 616.67 g/mol. Its IUPAC name is 8-(4-phenylmethoxyphenoxy)octyl 2-[4-chlorobutyl(methyl)amino]-3-phenylpropanoate;hydrochloride.
| Compound Name | 8-(4-phenylmethoxyphenoxy)octyl 2-[4-chlorobutyl(methyl)amino]-3-phenylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 10121778 |
| Molecular Formula | C35H47Cl2NO4 |
| Molecular Weight | 616.67 g/mol |
| Exact Mass | 615.29 |
| IUPAC Name | 8-(4-phenylmethoxyphenoxy)octyl 2-[4-chlorobutyl(methyl)amino]-3-phenylpropanoate;hydrochloride |
| SMILES | CN(CCCCCl)C(Cc1ccccc1)C(=O)OCCCCCCCCOc1ccc(OCc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C35H46ClNO4.ClH/c1-37(25-13-12-24-36)34(28-30-16-8-6-9-17-30)35(38)40-27-15-5-3-2-4-14-26-39-32-20-22-33(23-21-32)41-29-31-18-10-7-11-19-31;/h6-11,16-23,34H,2-5,12-15,24-29H2,1H3;1H |
| InChIKey | USXPQFFPPHOXGF-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.67 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|