C33H43ClNO4+ — CID 10190095
[1-[8-[4-[(2-chlorophenyl)methoxy]phenoxy]octoxy]-1-oxo-3-phenylpropan-2-yl]-trimethylazanium (PubChem CID 10190095) has the molecular formula C33H43ClNO4+ and a molecular weight of 553.16 g/mol. Its IUPAC name is [1-[8-[4-[(2-chlorophenyl)methoxy]phenoxy]octoxy]-1-oxo-3-phenylpropan-2-yl]-trimethylazanium.
| Compound Name | [1-[8-[4-[(2-chlorophenyl)methoxy]phenoxy]octoxy]-1-oxo-3-phenylpropan-2-yl]-trimethylazanium |
|---|---|
| PubChem CID | 10190095 |
| Molecular Formula | C33H43ClNO4+ |
| Molecular Weight | 553.16 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | [1-[8-[4-[(2-chlorophenyl)methoxy]phenoxy]octoxy]-1-oxo-3-phenylpropan-2-yl]-trimethylazanium |
| SMILES | C[N+](C)(C)C(Cc1ccccc1)C(=O)OCCCCCCCCOc1ccc(OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C33H43ClNO4/c1-35(2,3)32(25-27-15-9-8-10-16-27)33(36)38-24-14-7-5-4-6-13-23-37-29-19-21-30(22-20-29)39-26-28-17-11-12-18-31(28)34/h8-12,15-22,32H,4-7,13-14,23-26H2,1-3H3/q+1 |
| InChIKey | GCWIKJKBWILZSF-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.16 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|