[4-[(2-chlorophenyl)methoxy]phenyl]methanamine;oxalic acid

C16H16ClNO5 — CID 122170235

IUPAC[4-[(2-chlorophenyl)methoxy]phenyl]methanamine;oxalic acid
SMILESNCc1ccc(OCc2ccccc2Cl)cc1.O=C(O)C(=O)O
InChIInChI=1S/C14H14ClNO.C2H2O4/c15-14-4-2-1-3-12(14)10-17-13-7-5-11(9-16)6-8-13;3-1(4)2(5)6/h1-8H,9-10,16H2;(H,3,4)(H,5,6)
InChIKeyRCEKOHJLQDLITQ-UHFFFAOYSA-N
MW337.76 g/mol
LogP2.53
Rot. Bonds4

About [4-[(2-chlorophenyl)methoxy]phenyl]methanamine;oxalic acid

[4-[(2-chlorophenyl)methoxy]phenyl]methanamine;oxalic acid (PubChem CID 122170235) has the molecular formula C16H16ClNO5 and a molecular weight of 337.76 g/mol. Its IUPAC name is [4-[(2-chlorophenyl)methoxy]phenyl]methanamine;oxalic acid.

Molecular Properties

Compound Name[4-[(2-chlorophenyl)methoxy]phenyl]methanamine;oxalic acid
PubChem CID122170235
Molecular FormulaC16H16ClNO5
Molecular Weight337.76 g/mol
Exact Mass337.07
IUPAC Name[4-[(2-chlorophenyl)methoxy]phenyl]methanamine;oxalic acid
SMILESNCc1ccc(OCc2ccccc2Cl)cc1.O=C(O)C(=O)O
InChIInChI=1S/C14H14ClNO.C2H2O4/c15-14-4-2-1-3-12(14)10-17-13-7-5-11(9-16)6-8-13;3-1(4)2(5)6/h1-8H,9-10,16H2;(H,3,4)(H,5,6)
InChIKeyRCEKOHJLQDLITQ-UHFFFAOYSA-N
XLogP2.53
TPSA109.85 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500337.76
LogP ≤ 52.53
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze [4-[(2-chlorophenyl)methoxy]phenyl]methanamine;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [4-[(2-chlorophenyl)methoxy]phenyl]methanamine;oxalic acid?
The IUPAC name of [4-[(2-chlorophenyl)methoxy]phenyl]methanamine;oxalic acid (CID 122170235) is [4-[(2-chlorophenyl)methoxy]phenyl]methanamine;oxalic acid.
What is the SMILES notation for [4-[(2-chlorophenyl)methoxy]phenyl]methanamine;oxalic acid?
The canonical SMILES for [4-[(2-chlorophenyl)methoxy]phenyl]methanamine;oxalic acid is NCc1ccc(OCc2ccccc2Cl)cc1.O=C(O)C(=O)O.
What is the InChIKey of [4-[(2-chlorophenyl)methoxy]phenyl]methanamine;oxalic acid?
The InChIKey is RCEKOHJLQDLITQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClNO.C2H2O4/c15-14-4-2-1-3-12(14)10-17-13-7-5-11(9-16)6-8-13;3-1(4)2(5)6/h1-8H,9-10,16H2;(H,3,4)(H,5,6).
What are the key properties of [4-[(2-chlorophenyl)methoxy]phenyl]methanamine;oxalic acid?
[4-[(2-chlorophenyl)methoxy]phenyl]methanamine;oxalic acid has a molecular weight of 337.76 g/mol, XLogP of 2.53, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2-chlorophenyl)methoxy]phenyl]methanamine;oxalic acid is sourced from PubChem (CID 122170235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).