C33H44ClN2O3+ — CID 59989688
[(2S)-3-(3-chlorophenyl)-1-oxo-1-[8-(4-phenylmethoxyphenoxy)octylamino]propan-2-yl]-trimethylazanium (PubChem CID 59989688) has the molecular formula C33H44ClN2O3+ and a molecular weight of 552.18 g/mol. Its IUPAC name is [(2S)-3-(3-chlorophenyl)-1-oxo-1-[8-(4-phenylmethoxyphenoxy)octylamino]propan-2-yl]-trimethylazanium.
| Compound Name | [(2S)-3-(3-chlorophenyl)-1-oxo-1-[8-(4-phenylmethoxyphenoxy)octylamino]propan-2-yl]-trimethylazanium |
|---|---|
| PubChem CID | 59989688 |
| Molecular Formula | C33H44ClN2O3+ |
| Molecular Weight | 552.18 g/mol |
| Exact Mass | 551.30 |
| IUPAC Name | [(2S)-3-(3-chlorophenyl)-1-oxo-1-[8-(4-phenylmethoxyphenoxy)octylamino]propan-2-yl]-trimethylazanium |
| SMILES | C[N+](C)(C)[C@@H](Cc1cccc(Cl)c1)C(=O)NCCCCCCCCOc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C33H43ClN2O3/c1-36(2,3)32(25-28-16-13-17-29(34)24-28)33(37)35-22-11-6-4-5-7-12-23-38-30-18-20-31(21-19-30)39-26-27-14-9-8-10-15-27/h8-10,13-21,24,32H,4-7,11-12,22-23,25-26H2,1-3H3/p+1/t32-/m0/s1 |
| InChIKey | GANSGBOIOVPRSM-YTTGMZPUSA-O |
| XLogP | 7.07 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.18 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|