C34H46FIN2O4 — CID 158726567
[1-[8-[4-(2-fluorobenzoyl)oxyphenoxy]octylamino]-1-oxo-3-phenylpropan-2-yl]-trimethylazanium;methane;iodide (PubChem CID 158726567) has the molecular formula C34H46FIN2O4 and a molecular weight of 692.65 g/mol. Its IUPAC name is [1-[8-[4-(2-fluorobenzoyl)oxyphenoxy]octylamino]-1-oxo-3-phenylpropan-2-yl]-trimethylazanium;methane;iodide.
| Compound Name | [1-[8-[4-(2-fluorobenzoyl)oxyphenoxy]octylamino]-1-oxo-3-phenylpropan-2-yl]-trimethylazanium;methane;iodide |
|---|---|
| PubChem CID | 158726567 |
| Molecular Formula | C34H46FIN2O4 |
| Molecular Weight | 692.65 g/mol |
| Exact Mass | 692.25 |
| IUPAC Name | [1-[8-[4-(2-fluorobenzoyl)oxyphenoxy]octylamino]-1-oxo-3-phenylpropan-2-yl]-trimethylazanium;methane;iodide |
| SMILES | C.C[N+](C)(C)C(Cc1ccccc1)C(=O)NCCCCCCCCOc1ccc(OC(=O)c2ccccc2F)cc1.[I-] |
| InChI | InChI=1S/C33H41FN2O4.CH4.HI/c1-36(2,3)31(25-26-15-9-8-10-16-26)32(37)35-23-13-6-4-5-7-14-24-39-27-19-21-28(22-20-27)40-33(38)29-17-11-12-18-30(29)34;;/h8-12,15-22,31H,4-7,13-14,23-25H2,1-3H3;1H4;1H |
| InChIKey | NYRRHANBKDOSOT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.65 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|