C35H47IN2O3 — CID 10168685
2-(1-methylpyrrolidin-1-ium-1-yl)-3-phenyl-N-[8-(4-phenylmethoxyphenoxy)octyl]propanamide iodide (PubChem CID 10168685) has the molecular formula C35H47IN2O3 and a molecular weight of 670.68 g/mol. Its IUPAC name is 2-(1-methylpyrrolidin-1-ium-1-yl)-3-phenyl-N-[8-(4-phenylmethoxyphenoxy)octyl]propanamide iodide.
| Compound Name | 2-(1-methylpyrrolidin-1-ium-1-yl)-3-phenyl-N-[8-(4-phenylmethoxyphenoxy)octyl]propanamide iodide |
|---|---|
| PubChem CID | 10168685 |
| Molecular Formula | C35H47IN2O3 |
| Molecular Weight | 670.68 g/mol |
| Exact Mass | 670.26 |
| IUPAC Name | 2-(1-methylpyrrolidin-1-ium-1-yl)-3-phenyl-N-[8-(4-phenylmethoxyphenoxy)octyl]propanamide iodide |
| SMILES | C[N+]1(C(Cc2ccccc2)C(=O)NCCCCCCCCOc2ccc(OCc3ccccc3)cc2)CCCC1.[I-] |
| InChI | InChI=1S/C35H46N2O3.HI/c1-37(25-13-14-26-37)34(28-30-16-8-6-9-17-30)35(38)36-24-12-4-2-3-5-15-27-39-32-20-22-33(23-21-32)40-29-31-18-10-7-11-19-31;/h6-11,16-23,34H,2-5,12-15,24-29H2,1H3;1H |
| InChIKey | JPHPMNQNXHUWFA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.68 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|