C33H44N5O4+ — CID 142204728
[3-(4-acetamidophenyl)-1-oxo-1-[8-(4-phenylmethoxyphenoxy)octylamino]propan-2-yl]-(diaminomethylidene)azanium (PubChem CID 142204728) has the molecular formula C33H44N5O4+ and a molecular weight of 574.75 g/mol. Its IUPAC name is [3-(4-acetamidophenyl)-1-oxo-1-[8-(4-phenylmethoxyphenoxy)octylamino]propan-2-yl]-(diaminomethylidene)azanium.
| Compound Name | [3-(4-acetamidophenyl)-1-oxo-1-[8-(4-phenylmethoxyphenoxy)octylamino]propan-2-yl]-(diaminomethylidene)azanium |
|---|---|
| PubChem CID | 142204728 |
| Molecular Formula | C33H44N5O4+ |
| Molecular Weight | 574.75 g/mol |
| Exact Mass | 574.34 |
| IUPAC Name | [3-(4-acetamidophenyl)-1-oxo-1-[8-(4-phenylmethoxyphenoxy)octylamino]propan-2-yl]-(diaminomethylidene)azanium |
| SMILES | CC(=O)Nc1ccc(CC([NH+]=C(N)N)C(=O)NCCCCCCCCOc2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C33H43N5O4/c1-25(39)37-28-15-13-26(14-16-28)23-31(38-33(34)35)32(40)36-21-9-4-2-3-5-10-22-41-29-17-19-30(20-18-29)42-24-27-11-7-6-8-12-27/h6-8,11-20,31H,2-5,9-10,21-24H2,1H3,(H,36,40)(H,37,39)(H4,34,35,38)/p+1 |
| InChIKey | MQGYWUASRDCPGI-UHFFFAOYSA-O |
| XLogP | 3.02 |
| TPSA | 142.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.75 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|