C38H45N4O4+ — CID 135855061
[3-(4-benzoylphenyl)-1-oxo-1-[8-(4-phenylmethoxyphenoxy)octylamino]propan-2-yl]-(diaminomethylidene)azanium (PubChem CID 135855061) has the molecular formula C38H45N4O4+ and a molecular weight of 621.80 g/mol. Its IUPAC name is [3-(4-benzoylphenyl)-1-oxo-1-[8-(4-phenylmethoxyphenoxy)octylamino]propan-2-yl]-(diaminomethylidene)azanium.
| Compound Name | [3-(4-benzoylphenyl)-1-oxo-1-[8-(4-phenylmethoxyphenoxy)octylamino]propan-2-yl]-(diaminomethylidene)azanium |
|---|---|
| PubChem CID | 135855061 |
| Molecular Formula | C38H45N4O4+ |
| Molecular Weight | 621.80 g/mol |
| Exact Mass | 621.34 |
| IUPAC Name | [3-(4-benzoylphenyl)-1-oxo-1-[8-(4-phenylmethoxyphenoxy)octylamino]propan-2-yl]-(diaminomethylidene)azanium |
| SMILES | NC(N)=[NH+]C(Cc1ccc(C(=O)c2ccccc2)cc1)C(=O)NCCCCCCCCOc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C38H44N4O4/c39-38(40)42-35(27-29-17-19-32(20-18-29)36(43)31-15-9-6-10-16-31)37(44)41-25-11-3-1-2-4-12-26-45-33-21-23-34(24-22-33)46-28-30-13-7-5-8-14-30/h5-10,13-24,35H,1-4,11-12,25-28H2,(H,41,44)(H4,39,40,42)/p+1 |
| InChIKey | DGYMZDURUSGLEX-UHFFFAOYSA-O |
| XLogP | 4.30 |
| TPSA | 130.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.80 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|