C33H41Cl2IN2O4 — CID 10233973
[1-[8-[4-(2,3-dichlorobenzoyl)oxyphenoxy]octylamino]-1-oxo-3-phenylpropan-2-yl]-trimethylazanium iodide (PubChem CID 10233973) has the molecular formula C33H41Cl2IN2O4 and a molecular weight of 727.51 g/mol. Its IUPAC name is [1-[8-[4-(2,3-dichlorobenzoyl)oxyphenoxy]octylamino]-1-oxo-3-phenylpropan-2-yl]-trimethylazanium iodide.
| Compound Name | [1-[8-[4-(2,3-dichlorobenzoyl)oxyphenoxy]octylamino]-1-oxo-3-phenylpropan-2-yl]-trimethylazanium iodide |
|---|---|
| PubChem CID | 10233973 |
| Molecular Formula | C33H41Cl2IN2O4 |
| Molecular Weight | 727.51 g/mol |
| Exact Mass | 726.15 |
| IUPAC Name | [1-[8-[4-(2,3-dichlorobenzoyl)oxyphenoxy]octylamino]-1-oxo-3-phenylpropan-2-yl]-trimethylazanium iodide |
| SMILES | C[N+](C)(C)C(Cc1ccccc1)C(=O)NCCCCCCCCOc1ccc(OC(=O)c2cccc(Cl)c2Cl)cc1.[I-] |
| InChI | InChI=1S/C33H40Cl2N2O4.HI/c1-37(2,3)30(24-25-14-9-8-10-15-25)32(38)36-22-11-6-4-5-7-12-23-40-26-18-20-27(21-19-26)41-33(39)28-16-13-17-29(34)31(28)35;/h8-10,13-21,30H,4-7,11-12,22-24H2,1-3H3;1H |
| InChIKey | AAXCZTUFVCPKMN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|