C32H39Cl2N2O4+ — CID 20762015
[4-[2-[8-[4-(2,6-dichlorobenzoyl)oxyphenoxy]octylamino]-2-oxoethyl]phenyl]-trimethylazanium (PubChem CID 20762015) has the molecular formula C32H39Cl2N2O4+ and a molecular weight of 586.58 g/mol. Its IUPAC name is [4-[2-[8-[4-(2,6-dichlorobenzoyl)oxyphenoxy]octylamino]-2-oxoethyl]phenyl]-trimethylazanium.
| Compound Name | [4-[2-[8-[4-(2,6-dichlorobenzoyl)oxyphenoxy]octylamino]-2-oxoethyl]phenyl]-trimethylazanium |
|---|---|
| PubChem CID | 20762015 |
| Molecular Formula | C32H39Cl2N2O4+ |
| Molecular Weight | 586.58 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | [4-[2-[8-[4-(2,6-dichlorobenzoyl)oxyphenoxy]octylamino]-2-oxoethyl]phenyl]-trimethylazanium |
| SMILES | C[N+](C)(C)c1ccc(CC(=O)NCCCCCCCCOc2ccc(OC(=O)c3c(Cl)cccc3Cl)cc2)cc1 |
| InChI | InChI=1S/C32H38Cl2N2O4/c1-36(2,3)25-15-13-24(14-16-25)23-30(37)35-21-8-6-4-5-7-9-22-39-26-17-19-27(20-18-26)40-32(38)31-28(33)11-10-12-29(31)34/h10-20H,4-9,21-23H2,1-3H3/p+1 |
| InChIKey | VOHRRZYHTFTSJN-UHFFFAOYSA-O |
| XLogP | 7.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.58 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|