C36H52ClN2O4+ — CID 142204932
[4-[2-[8-[4-(3-chlorobenzoyl)oxyphenoxy]octylamino]-2-oxoethyl]phenyl]-trimethylazanium;ethane (PubChem CID 142204932) has the molecular formula C36H52ClN2O4+ and a molecular weight of 612.28 g/mol. Its IUPAC name is [4-[2-[8-[4-(3-chlorobenzoyl)oxyphenoxy]octylamino]-2-oxoethyl]phenyl]-trimethylazanium;ethane.
| Compound Name | [4-[2-[8-[4-(3-chlorobenzoyl)oxyphenoxy]octylamino]-2-oxoethyl]phenyl]-trimethylazanium;ethane |
|---|---|
| PubChem CID | 142204932 |
| Molecular Formula | C36H52ClN2O4+ |
| Molecular Weight | 612.28 g/mol |
| Exact Mass | 611.36 |
| IUPAC Name | [4-[2-[8-[4-(3-chlorobenzoyl)oxyphenoxy]octylamino]-2-oxoethyl]phenyl]-trimethylazanium;ethane |
| SMILES | CC.CC.C[N+](C)(C)c1ccc(CC(=O)NCCCCCCCCOc2ccc(OC(=O)c3cccc(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C32H39ClN2O4.2C2H6/c1-35(2,3)28-15-13-25(14-16-28)23-31(36)34-21-8-6-4-5-7-9-22-38-29-17-19-30(20-18-29)39-32(37)26-11-10-12-27(33)24-26;2*1-2/h10-20,24H,4-9,21-23H2,1-3H3;2*1-2H3/p+1 |
| InChIKey | BCTRSBUCKNERED-UHFFFAOYSA-O |
| XLogP | 8.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.28 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|