C28H31Cl2IN2O4 — CID 10189840
[4-[8-[(1-methylpyridin-1-ium-3-carbonyl)amino]octoxy]phenyl] 3,4-dichlorobenzoate iodide (PubChem CID 10189840) has the molecular formula C28H31Cl2IN2O4 and a molecular weight of 657.38 g/mol. Its IUPAC name is [4-[8-[(1-methylpyridin-1-ium-3-carbonyl)amino]octoxy]phenyl] 3,4-dichlorobenzoate iodide.
| Compound Name | [4-[8-[(1-methylpyridin-1-ium-3-carbonyl)amino]octoxy]phenyl] 3,4-dichlorobenzoate iodide |
|---|---|
| PubChem CID | 10189840 |
| Molecular Formula | C28H31Cl2IN2O4 |
| Molecular Weight | 657.38 g/mol |
| Exact Mass | 656.07 |
| IUPAC Name | [4-[8-[(1-methylpyridin-1-ium-3-carbonyl)amino]octoxy]phenyl] 3,4-dichlorobenzoate iodide |
| SMILES | C[n+]1cccc(C(=O)NCCCCCCCCOc2ccc(OC(=O)c3ccc(Cl)c(Cl)c3)cc2)c1.[I-] |
| InChI | InChI=1S/C28H30Cl2N2O4.HI/c1-32-17-8-9-22(20-32)27(33)31-16-6-4-2-3-5-7-18-35-23-11-13-24(14-12-23)36-28(34)21-10-15-25(29)26(30)19-21;/h8-15,17,19-20H,2-7,16,18H2,1H3;1H |
| InChIKey | QTTPRTPOFJUUDS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|