C30H37Cl2N2O4+ — CID 142204816
ethane;[4-[8-[(1-methylpyridin-1-ium-3-carbonyl)amino]octoxy]phenyl] 2,5-dichlorobenzoate (PubChem CID 142204816) has the molecular formula C30H37Cl2N2O4+ and a molecular weight of 560.54 g/mol. Its IUPAC name is ethane;[4-[8-[(1-methylpyridin-1-ium-3-carbonyl)amino]octoxy]phenyl] 2,5-dichlorobenzoate.
| Compound Name | ethane;[4-[8-[(1-methylpyridin-1-ium-3-carbonyl)amino]octoxy]phenyl] 2,5-dichlorobenzoate |
|---|---|
| PubChem CID | 142204816 |
| Molecular Formula | C30H37Cl2N2O4+ |
| Molecular Weight | 560.54 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | ethane;[4-[8-[(1-methylpyridin-1-ium-3-carbonyl)amino]octoxy]phenyl] 2,5-dichlorobenzoate |
| SMILES | CC.C[n+]1cccc(C(=O)NCCCCCCCCOc2ccc(OC(=O)c3cc(Cl)ccc3Cl)cc2)c1 |
| InChI | InChI=1S/C28H30Cl2N2O4.C2H6/c1-32-17-8-9-21(20-32)27(33)31-16-6-4-2-3-5-7-18-35-23-11-13-24(14-12-23)36-28(34)25-19-22(29)10-15-26(25)30;1-2/h8-15,17,19-20H,2-7,16,18H2,1H3;1-2H3/p+1 |
| InChIKey | MWUGZHOIXKISFA-UHFFFAOYSA-O |
| XLogP | 7.21 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.54 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|