C23H30ClNO5 — CID 16571870
N-[4-(4-chlorophenoxy)butyl]-3,4,5-triethoxybenzamide (PubChem CID 16571870) has the molecular formula C23H30ClNO5 and a molecular weight of 435.95 g/mol. Its IUPAC name is N-[4-(4-chlorophenoxy)butyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[4-(4-chlorophenoxy)butyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 16571870 |
| Molecular Formula | C23H30ClNO5 |
| Molecular Weight | 435.95 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | N-[4-(4-chlorophenoxy)butyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NCCCCOc2ccc(Cl)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H30ClNO5/c1-4-27-20-15-17(16-21(28-5-2)22(20)29-6-3)23(26)25-13-7-8-14-30-19-11-9-18(24)10-12-19/h9-12,15-16H,4-8,13-14H2,1-3H3,(H,25,26) |
| InChIKey | MXNKXOZXJZHQPJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.95 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|